C13H12BrClN4O — CID 79302970
5-[[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3-methyl-1,2-oxazole (PubChem CID 79302970) has the molecular formula C13H12BrClN4O and a molecular weight of 355.62 g/mol. Its IUPAC name is 5-[[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 79302970 |
| Molecular Formula | C13H12BrClN4O |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 5-[[6-bromo-2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(Cn2c(CCCl)nc3cc(Br)cnc32)on1 |
| InChI | InChI=1S/C13H12BrClN4O/c1-8-4-10(20-18-8)7-19-12(2-3-15)17-11-5-9(14)6-16-13(11)19/h4-6H,2-3,7H2,1H3 |
| InChIKey | TYPWUKLXCMDYKO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|