C13H11BrClN3S — CID 79301975
6-bromo-2-(chloromethyl)-3-(2-thiophen-3-ylethyl)imidazo[4,5-b]pyridine (PubChem CID 79301975) has the molecular formula C13H11BrClN3S and a molecular weight of 356.68 g/mol. Its IUPAC name is 6-bromo-2-(chloromethyl)-3-(2-thiophen-3-ylethyl)imidazo[4,5-b]pyridine.
| Compound Name | 6-bromo-2-(chloromethyl)-3-(2-thiophen-3-ylethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79301975 |
| Molecular Formula | C13H11BrClN3S |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 6-bromo-2-(chloromethyl)-3-(2-thiophen-3-ylethyl)imidazo[4,5-b]pyridine |
| SMILES | ClCc1nc2cc(Br)cnc2n1CCc1ccsc1 |
| InChI | InChI=1S/C13H11BrClN3S/c14-10-5-11-13(16-7-10)18(12(6-15)17-11)3-1-9-2-4-19-8-9/h2,4-5,7-8H,1,3,6H2 |
| InChIKey | LGEMWSOLKLIXCL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|