C11H13ClFN3OS — CID 114089476
6-chloro-1-(2-ethylsulfinylethyl)-5-fluorobenzimidazol-2-amine (PubChem CID 114089476) has the molecular formula C11H13ClFN3OS and a molecular weight of 289.76 g/mol. Its IUPAC name is 6-chloro-1-(2-ethylsulfinylethyl)-5-fluorobenzimidazol-2-amine.
| Compound Name | 6-chloro-1-(2-ethylsulfinylethyl)-5-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 114089476 |
| Molecular Formula | C11H13ClFN3OS |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 6-chloro-1-(2-ethylsulfinylethyl)-5-fluorobenzimidazol-2-amine |
| SMILES | CCS(=O)CCn1c(N)nc2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C11H13ClFN3OS/c1-2-18(17)4-3-16-10-5-7(12)8(13)6-9(10)15-11(16)14/h5-6H,2-4H2,1H3,(H2,14,15) |
| InChIKey | QWOMRIOCCKHQLN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |