C11H13F2N3S — CID 113466697
6,7-difluoro-1-(2-methylsulfanylpropyl)benzimidazol-2-amine (PubChem CID 113466697) has the molecular formula C11H13F2N3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 6,7-difluoro-1-(2-methylsulfanylpropyl)benzimidazol-2-amine.
| Compound Name | 6,7-difluoro-1-(2-methylsulfanylpropyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 113466697 |
| Molecular Formula | C11H13F2N3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 6,7-difluoro-1-(2-methylsulfanylpropyl)benzimidazol-2-amine |
| SMILES | CSC(C)Cn1c(N)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C11H13F2N3S/c1-6(17-2)5-16-10-8(15-11(16)14)4-3-7(12)9(10)13/h3-4,6H,5H2,1-2H3,(H2,14,15) |
| InChIKey | KVBFRCCRCDPQNG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |