C14H11F2N3S — CID 107645393
6,7-difluoro-1-(2-methylsulfanylphenyl)benzimidazol-2-amine (PubChem CID 107645393) has the molecular formula C14H11F2N3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 6,7-difluoro-1-(2-methylsulfanylphenyl)benzimidazol-2-amine.
| Compound Name | 6,7-difluoro-1-(2-methylsulfanylphenyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 107645393 |
| Molecular Formula | C14H11F2N3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 6,7-difluoro-1-(2-methylsulfanylphenyl)benzimidazol-2-amine |
| SMILES | CSc1ccccc1-n1c(N)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C14H11F2N3S/c1-20-11-5-3-2-4-10(11)19-13-9(18-14(19)17)7-6-8(15)12(13)16/h2-7H,1H3,(H2,17,18) |
| InChIKey | VTZPGUATSPAUCN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |