C14H15ClFN5 — CID 103593950
2-(2-chloroethyl)-5-fluoro-6-methyl-1-[2-(triazol-1-yl)ethyl]benzimidazole (PubChem CID 103593950) has the molecular formula C14H15ClFN5 and a molecular weight of 307.76 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-fluoro-6-methyl-1-[2-(triazol-1-yl)ethyl]benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-fluoro-6-methyl-1-[2-(triazol-1-yl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 103593950 |
| Molecular Formula | C14H15ClFN5 |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(2-chloroethyl)-5-fluoro-6-methyl-1-[2-(triazol-1-yl)ethyl]benzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(CCCl)n2CCn1ccnn1 |
| InChI | InChI=1S/C14H15ClFN5/c1-10-8-13-12(9-11(10)16)18-14(2-3-15)21(13)7-6-20-5-4-17-19-20/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | ZNACOPWTROSBLD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|