C15H19ClFN3O — CID 115357059
N-tert-butyl-2-[2-(2-chloroethyl)-5-fluorobenzimidazol-1-yl]acetamide (PubChem CID 115357059) has the molecular formula C15H19ClFN3O and a molecular weight of 311.79 g/mol. Its IUPAC name is N-tert-butyl-2-[2-(2-chloroethyl)-5-fluorobenzimidazol-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[2-(2-chloroethyl)-5-fluorobenzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 115357059 |
| Molecular Formula | C15H19ClFN3O |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-tert-butyl-2-[2-(2-chloroethyl)-5-fluorobenzimidazol-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)Cn1c(CCCl)nc2cc(F)ccc21 |
| InChI | InChI=1S/C15H19ClFN3O/c1-15(2,3)19-14(21)9-20-12-5-4-10(17)8-11(12)18-13(20)6-7-16/h4-5,8H,6-7,9H2,1-3H3,(H,19,21) |
| InChIKey | LTDLFEVDDPPFMF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|