C13H15ClFN3O — CID 43661209
2-[2-(chloromethyl)-5-fluorobenzimidazol-1-yl]-N-propylacetamide (PubChem CID 43661209) has the molecular formula C13H15ClFN3O and a molecular weight of 283.73 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-5-fluorobenzimidazol-1-yl]-N-propylacetamide.
| Compound Name | 2-[2-(chloromethyl)-5-fluorobenzimidazol-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 43661209 |
| Molecular Formula | C13H15ClFN3O |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[2-(chloromethyl)-5-fluorobenzimidazol-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)Cn1c(CCl)nc2cc(F)ccc21 |
| InChI | InChI=1S/C13H15ClFN3O/c1-2-5-16-13(19)8-18-11-4-3-9(15)6-10(11)17-12(18)7-14/h3-4,6H,2,5,7-8H2,1H3,(H,16,19) |
| InChIKey | WZFHTGZBKFYLJU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|