C14H14ClFN4O — CID 106420320
5-[2-[2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole (PubChem CID 106420320) has the molecular formula C14H14ClFN4O and a molecular weight of 308.74 g/mol. Its IUPAC name is 5-[2-[2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[2-[2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106420320 |
| Molecular Formula | C14H14ClFN4O |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-[2-[2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(CCn2c(CCCl)nc3ccc(F)cc32)n1 |
| InChI | InChI=1S/C14H14ClFN4O/c1-9-17-14(21-19-9)5-7-20-12-8-10(16)2-3-11(12)18-13(20)4-6-15/h2-3,8H,4-7H2,1H3 |
| InChIKey | ZUHARRWTMGVWTP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|