C13H11Cl3N4O — CID 106420402
5-[2-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole (PubChem CID 106420402) has the molecular formula C13H11Cl3N4O and a molecular weight of 345.62 g/mol. Its IUPAC name is 5-[2-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[2-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106420402 |
| Molecular Formula | C13H11Cl3N4O |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 5-[2-[5,6-dichloro-2-(chloromethyl)benzimidazol-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(CCn2c(CCl)nc3cc(Cl)c(Cl)cc32)n1 |
| InChI | InChI=1S/C13H11Cl3N4O/c1-7-17-13(21-19-7)2-3-20-11-5-9(16)8(15)4-10(11)18-12(20)6-14/h4-5H,2-3,6H2,1H3 |
| InChIKey | YLZAXNPIYGBRPY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|