C14H16Cl2FN3O — CID 66112385
2-[5-chloro-2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]-N,N-dimethylpropanamide (PubChem CID 66112385) has the molecular formula C14H16Cl2FN3O and a molecular weight of 332.21 g/mol. Its IUPAC name is 2-[5-chloro-2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]-N,N-dimethylpropanamide.
| Compound Name | 2-[5-chloro-2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 66112385 |
| Molecular Formula | C14H16Cl2FN3O |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-[5-chloro-2-(2-chloroethyl)-6-fluorobenzimidazol-1-yl]-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)n1c(CCCl)nc2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C14H16Cl2FN3O/c1-8(14(21)19(2)3)20-12-7-10(17)9(16)6-11(12)18-13(20)4-5-15/h6-8H,4-5H2,1-3H3 |
| InChIKey | MXZWWLVZAJHFPZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|