About 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide
2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide (PubChem CID 115509291) has the molecular formula C14H16ClF2N3O
and a molecular weight of 315.75 g/mol. Its IUPAC name is 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide |
| PubChem CID | 115509291 |
| Molecular Formula | C14H16ClF2N3O |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)n1c(CCCl)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C14H16ClF2N3O/c1-8(14(21)19(2)3)20-11-7-9(16)6-10(17)13(11)18-12(20)4-5-15/h6-8H,4-5H2,1-3H3 |
| InChIKey | UJSIIILXXMDZPS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide?
The IUPAC name of 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide (CID 115509291) is 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide.
What is the SMILES notation for 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide?
The canonical SMILES for 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide is CC(C(=O)N(C)C)n1c(CCCl)nc2c(F)cc(F)cc21.
What is the InChIKey of 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide?
The InChIKey is UJSIIILXXMDZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClF2N3O/c1-8(14(21)19(2)3)20-11-7-9(16)6-10(17)13(11)18-12(20)4-5-15/h6-8H,4-5H2,1-3H3.
What are the key properties of 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide?
2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide has a molecular weight of 315.75 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-N,N-dimethylpropanamide is sourced from PubChem (CID 115509291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).