C13H13ClF2N2 — CID 115508994
2-(2-chloroethyl)-1-(cyclopropylmethyl)-4,6-difluorobenzimidazole (PubChem CID 115508994) has the molecular formula C13H13ClF2N2 and a molecular weight of 270.71 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(cyclopropylmethyl)-4,6-difluorobenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(cyclopropylmethyl)-4,6-difluorobenzimidazole |
|---|---|
| PubChem CID | 115508994 |
| Molecular Formula | C13H13ClF2N2 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(2-chloroethyl)-1-(cyclopropylmethyl)-4,6-difluorobenzimidazole |
| SMILES | Fc1cc(F)c2nc(CCCl)n(CC3CC3)c2c1 |
| InChI | InChI=1S/C13H13ClF2N2/c14-4-3-12-17-13-10(16)5-9(15)6-11(13)18(12)7-8-1-2-8/h5-6,8H,1-4,7H2 |
| InChIKey | ODCPLHJINDTHRB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|