C13H15F2N3 — CID 113325607
1-(cyclopentylmethyl)-4,6-difluorobenzimidazol-2-amine (PubChem CID 113325607) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-4,6-difluorobenzimidazol-2-amine.
| Compound Name | 1-(cyclopentylmethyl)-4,6-difluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 113325607 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-(cyclopentylmethyl)-4,6-difluorobenzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cc(F)cc2n1CC1CCCC1 |
| InChI | InChI=1S/C13H15F2N3/c14-9-5-10(15)12-11(6-9)18(13(16)17-12)7-8-3-1-2-4-8/h5-6,8H,1-4,7H2,(H2,16,17) |
| InChIKey | ZMYOJNGYWVCTBZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |