C15H19F2N3 — CID 115508550
1-cyclooctyl-4,6-difluorobenzimidazol-2-amine (PubChem CID 115508550) has the molecular formula C15H19F2N3 and a molecular weight of 279.33 g/mol. Its IUPAC name is 1-cyclooctyl-4,6-difluorobenzimidazol-2-amine.
| Compound Name | 1-cyclooctyl-4,6-difluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 115508550 |
| Molecular Formula | C15H19F2N3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-cyclooctyl-4,6-difluorobenzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cc(F)cc2n1C1CCCCCCC1 |
| InChI | InChI=1S/C15H19F2N3/c16-10-8-12(17)14-13(9-10)20(15(18)19-14)11-6-4-2-1-3-5-7-11/h8-9,11H,1-7H2,(H2,18,19) |
| InChIKey | VSOUAXQTUIDMCW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |