C11H9ClF2N2 — CID 115509040
2-(chloromethyl)-1-cyclopropyl-4,6-difluorobenzimidazole (PubChem CID 115509040) has the molecular formula C11H9ClF2N2 and a molecular weight of 242.66 g/mol. Its IUPAC name is 2-(chloromethyl)-1-cyclopropyl-4,6-difluorobenzimidazole.
| Compound Name | 2-(chloromethyl)-1-cyclopropyl-4,6-difluorobenzimidazole |
|---|---|
| PubChem CID | 115509040 |
| Molecular Formula | C11H9ClF2N2 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-(chloromethyl)-1-cyclopropyl-4,6-difluorobenzimidazole |
| SMILES | Fc1cc(F)c2nc(CCl)n(C3CC3)c2c1 |
| InChI | InChI=1S/C11H9ClF2N2/c12-5-10-15-11-8(14)3-6(13)4-9(11)16(10)7-1-2-7/h3-4,7H,1-2,5H2 |
| InChIKey | GNVSJJWXWWATSM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|