C14H15ClF2N2O — CID 115509428
2-(chloromethyl)-4,6-difluoro-1-(2-methoxycyclopentyl)benzimidazole (PubChem CID 115509428) has the molecular formula C14H15ClF2N2O and a molecular weight of 300.74 g/mol. Its IUPAC name is 2-(chloromethyl)-4,6-difluoro-1-(2-methoxycyclopentyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-4,6-difluoro-1-(2-methoxycyclopentyl)benzimidazole |
|---|---|
| PubChem CID | 115509428 |
| Molecular Formula | C14H15ClF2N2O |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(chloromethyl)-4,6-difluoro-1-(2-methoxycyclopentyl)benzimidazole |
| SMILES | COC1CCCC1n1c(CCl)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C14H15ClF2N2O/c1-20-12-4-2-3-10(12)19-11-6-8(16)5-9(17)14(11)18-13(19)7-15/h5-6,10,12H,2-4,7H2,1H3 |
| InChIKey | SBKRIOZBKYGOOM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|