C14H15ClF2N2 — CID 113325667
2-(2-chloroethyl)-1-(cyclobutylmethyl)-4,6-difluorobenzimidazole (PubChem CID 113325667) has the molecular formula C14H15ClF2N2 and a molecular weight of 284.74 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(cyclobutylmethyl)-4,6-difluorobenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(cyclobutylmethyl)-4,6-difluorobenzimidazole |
|---|---|
| PubChem CID | 113325667 |
| Molecular Formula | C14H15ClF2N2 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-(2-chloroethyl)-1-(cyclobutylmethyl)-4,6-difluorobenzimidazole |
| SMILES | Fc1cc(F)c2nc(CCCl)n(CC3CCC3)c2c1 |
| InChI | InChI=1S/C14H15ClF2N2/c15-5-4-13-18-14-11(17)6-10(16)7-12(14)19(13)8-9-2-1-3-9/h6-7,9H,1-5,8H2 |
| InChIKey | OAZKVHMSDRQWIM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|