C15H18ClF2N3 — CID 115509365
2-(chloromethyl)-4,6-difluoro-1-[(1-methylpiperidin-2-yl)methyl]benzimidazole (PubChem CID 115509365) has the molecular formula C15H18ClF2N3 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-(chloromethyl)-4,6-difluoro-1-[(1-methylpiperidin-2-yl)methyl]benzimidazole.
| Compound Name | 2-(chloromethyl)-4,6-difluoro-1-[(1-methylpiperidin-2-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 115509365 |
| Molecular Formula | C15H18ClF2N3 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(chloromethyl)-4,6-difluoro-1-[(1-methylpiperidin-2-yl)methyl]benzimidazole |
| SMILES | CN1CCCCC1Cn1c(CCl)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C15H18ClF2N3/c1-20-5-3-2-4-11(20)9-21-13-7-10(17)6-12(18)15(13)19-14(21)8-16/h6-7,11H,2-5,8-9H2,1H3 |
| InChIKey | DLQMHCWKVKCVGQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|