C12H13ClF2N2 — CID 115509041
2-(chloromethyl)-4,6-difluoro-1-(2-methylpropyl)benzimidazole (PubChem CID 115509041) has the molecular formula C12H13ClF2N2 and a molecular weight of 258.70 g/mol. Its IUPAC name is 2-(chloromethyl)-4,6-difluoro-1-(2-methylpropyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-4,6-difluoro-1-(2-methylpropyl)benzimidazole |
|---|---|
| PubChem CID | 115509041 |
| Molecular Formula | C12H13ClF2N2 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(chloromethyl)-4,6-difluoro-1-(2-methylpropyl)benzimidazole |
| SMILES | CC(C)Cn1c(CCl)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H13ClF2N2/c1-7(2)6-17-10-4-8(14)3-9(15)12(10)16-11(17)5-13/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | NZYKBONIRXEUII-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|