C13H10ClF2N3S — CID 115509344
2-[[2-(chloromethyl)-4,6-difluorobenzimidazol-1-yl]methyl]-4-methyl-1,3-thiazole (PubChem CID 115509344) has the molecular formula C13H10ClF2N3S and a molecular weight of 313.76 g/mol. Its IUPAC name is 2-[[2-(chloromethyl)-4,6-difluorobenzimidazol-1-yl]methyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[[2-(chloromethyl)-4,6-difluorobenzimidazol-1-yl]methyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 115509344 |
| Molecular Formula | C13H10ClF2N3S |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-[[2-(chloromethyl)-4,6-difluorobenzimidazol-1-yl]methyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(Cn2c(CCl)nc3c(F)cc(F)cc32)n1 |
| InChI | InChI=1S/C13H10ClF2N3S/c1-7-6-20-12(17-7)5-19-10-3-8(15)2-9(16)13(10)18-11(19)4-14/h2-3,6H,4-5H2,1H3 |
| InChIKey | LWELSRPTBBLCFG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|