C14H15BrClFN2 — CID 66087515
5-bromo-2-(chloromethyl)-6-fluoro-1-(2-methylcyclopentyl)benzimidazole (PubChem CID 66087515) has the molecular formula C14H15BrClFN2 and a molecular weight of 345.64 g/mol. Its IUPAC name is 5-bromo-2-(chloromethyl)-6-fluoro-1-(2-methylcyclopentyl)benzimidazole.
| Compound Name | 5-bromo-2-(chloromethyl)-6-fluoro-1-(2-methylcyclopentyl)benzimidazole |
|---|---|
| PubChem CID | 66087515 |
| Molecular Formula | C14H15BrClFN2 |
| Molecular Weight | 345.64 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 5-bromo-2-(chloromethyl)-6-fluoro-1-(2-methylcyclopentyl)benzimidazole |
| SMILES | CC1CCCC1n1c(CCl)nc2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C14H15BrClFN2/c1-8-3-2-4-12(8)19-13-6-10(17)9(15)5-11(13)18-14(19)7-16/h5-6,8,12H,2-4,7H2,1H3 |
| InChIKey | HRQKFDBGXWMBSD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|