C14H13BrClFN2O — CID 116739246
6-bromo-2-(chloromethyl)-5-fluoro-1-(7-oxabicyclo[2.2.1]heptan-2-yl)benzimidazole (PubChem CID 116739246) has the molecular formula C14H13BrClFN2O and a molecular weight of 359.63 g/mol. Its IUPAC name is 6-bromo-2-(chloromethyl)-5-fluoro-1-(7-oxabicyclo[2.2.1]heptan-2-yl)benzimidazole.
| Compound Name | 6-bromo-2-(chloromethyl)-5-fluoro-1-(7-oxabicyclo[2.2.1]heptan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 116739246 |
| Molecular Formula | C14H13BrClFN2O |
| Molecular Weight | 359.63 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 6-bromo-2-(chloromethyl)-5-fluoro-1-(7-oxabicyclo[2.2.1]heptan-2-yl)benzimidazole |
| SMILES | Fc1cc2nc(CCl)n(C3CC4CCC3O4)c2cc1Br |
| InChI | InChI=1S/C14H13BrClFN2O/c15-8-4-11-10(5-9(8)17)18-14(6-16)19(11)12-3-7-1-2-13(12)20-7/h4-5,7,12-13H,1-3,6H2 |
| InChIKey | NPKCYZOBZGWMLJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|