C15H16BrClFN3 — CID 116738926
6-bromo-2-(chloromethyl)-5-fluoro-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzimidazole (PubChem CID 116738926) has the molecular formula C15H16BrClFN3 and a molecular weight of 372.67 g/mol. Its IUPAC name is 6-bromo-2-(chloromethyl)-5-fluoro-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzimidazole.
| Compound Name | 6-bromo-2-(chloromethyl)-5-fluoro-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzimidazole |
|---|---|
| PubChem CID | 116738926 |
| Molecular Formula | C15H16BrClFN3 |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 6-bromo-2-(chloromethyl)-5-fluoro-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)benzimidazole |
| SMILES | Fc1cc2nc(CCl)n(C3CCN4CCCC34)c2cc1Br |
| InChI | InChI=1S/C15H16BrClFN3/c16-9-6-14-11(7-10(9)18)19-15(8-17)21(14)13-3-5-20-4-1-2-12(13)20/h6-7,12-13H,1-5,8H2 |
| InChIKey | PMMBHUMVIRNAAZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|