C13H6F5N3 — CID 115508935
4,6-difluoro-1-(2,4,6-trifluorophenyl)benzimidazol-2-amine (PubChem CID 115508935) has the molecular formula C13H6F5N3 and a molecular weight of 299.20 g/mol. Its IUPAC name is 4,6-difluoro-1-(2,4,6-trifluorophenyl)benzimidazol-2-amine.
| Compound Name | 4,6-difluoro-1-(2,4,6-trifluorophenyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115508935 |
| Molecular Formula | C13H6F5N3 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4,6-difluoro-1-(2,4,6-trifluorophenyl)benzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cc(F)cc2n1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H6F5N3/c14-5-2-8(17)12(9(18)3-5)21-10-4-6(15)1-7(16)11(10)20-13(21)19/h1-4H,(H2,19,20) |
| InChIKey | OYRMOTNNSFMRMV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |