C13H7ClF2IN3 — CID 107637379
1-(4-chloro-2-iodophenyl)-4,6-difluorobenzimidazol-2-amine (PubChem CID 107637379) has the molecular formula C13H7ClF2IN3 and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-(4-chloro-2-iodophenyl)-4,6-difluorobenzimidazol-2-amine.
| Compound Name | 1-(4-chloro-2-iodophenyl)-4,6-difluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 107637379 |
| Molecular Formula | C13H7ClF2IN3 |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 404.93 |
| IUPAC Name | 1-(4-chloro-2-iodophenyl)-4,6-difluorobenzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cc(F)cc2n1-c1ccc(Cl)cc1I |
| InChI | InChI=1S/C13H7ClF2IN3/c14-6-1-2-10(9(17)3-6)20-11-5-7(15)4-8(16)12(11)19-13(20)18/h1-5H,(H2,18,19) |
| InChIKey | YXNUBWMHQCVQJX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|