C13H6BrF4N3 — CID 107613935
1-(4-bromo-2,5-difluorophenyl)-4,6-difluorobenzimidazol-2-amine (PubChem CID 107613935) has the molecular formula C13H6BrF4N3 and a molecular weight of 360.11 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-4,6-difluorobenzimidazol-2-amine.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-4,6-difluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 107613935 |
| Molecular Formula | C13H6BrF4N3 |
| Molecular Weight | 360.11 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-4,6-difluorobenzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cc(F)cc2n1-c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C13H6BrF4N3/c14-6-3-8(17)10(4-7(6)16)21-11-2-5(15)1-9(18)12(11)20-13(21)19/h1-4H,(H2,19,20) |
| InChIKey | JIHJEOQKGHUIJZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.11 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|