C14H10BrF2N3 — CID 115508690
1-(5-bromo-2-methylphenyl)-4,6-difluorobenzimidazol-2-amine (PubChem CID 115508690) has the molecular formula C14H10BrF2N3 and a molecular weight of 338.16 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-4,6-difluorobenzimidazol-2-amine.
| Compound Name | 1-(5-bromo-2-methylphenyl)-4,6-difluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 115508690 |
| Molecular Formula | C14H10BrF2N3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-4,6-difluorobenzimidazol-2-amine |
| SMILES | Cc1ccc(Br)cc1-n1c(N)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C14H10BrF2N3/c1-7-2-3-8(15)4-11(7)20-12-6-9(16)5-10(17)13(12)19-14(20)18/h2-6H,1H3,(H2,18,19) |
| InChIKey | BLFBXQAGEUVXTM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |