C12H10F2N4S — CID 115508865
4,6-difluoro-1-[2-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine (PubChem CID 115508865) has the molecular formula C12H10F2N4S and a molecular weight of 280.30 g/mol. Its IUPAC name is 4,6-difluoro-1-[2-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 4,6-difluoro-1-[2-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 115508865 |
| Molecular Formula | C12H10F2N4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 4,6-difluoro-1-[2-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cc(F)cc2n1CCc1nccs1 |
| InChI | InChI=1S/C12H10F2N4S/c13-7-5-8(14)11-9(6-7)18(12(15)17-11)3-1-10-16-2-4-19-10/h2,4-6H,1,3H2,(H2,15,17) |
| InChIKey | ZHOJIDGAKLQLSH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |