C11H10F5N3O — CID 115508885
4,6-difluoro-1-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazol-2-amine (PubChem CID 115508885) has the molecular formula C11H10F5N3O and a molecular weight of 295.21 g/mol. Its IUPAC name is 4,6-difluoro-1-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazol-2-amine.
| Compound Name | 4,6-difluoro-1-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 115508885 |
| Molecular Formula | C11H10F5N3O |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4,6-difluoro-1-[2-(2,2,2-trifluoroethoxy)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cc(F)cc2n1CCOCC(F)(F)F |
| InChI | InChI=1S/C11H10F5N3O/c12-6-3-7(13)9-8(4-6)19(10(17)18-9)1-2-20-5-11(14,15)16/h3-4H,1-2,5H2,(H2,17,18) |
| InChIKey | GNLJANJPBIJGNY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|