C12H9F2N3S — CID 115508867
4,6-difluoro-1-(thiophen-3-ylmethyl)benzimidazol-2-amine (PubChem CID 115508867) has the molecular formula C12H9F2N3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 4,6-difluoro-1-(thiophen-3-ylmethyl)benzimidazol-2-amine.
| Compound Name | 4,6-difluoro-1-(thiophen-3-ylmethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115508867 |
| Molecular Formula | C12H9F2N3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 4,6-difluoro-1-(thiophen-3-ylmethyl)benzimidazol-2-amine |
| SMILES | Nc1nc2c(F)cc(F)cc2n1Cc1ccsc1 |
| InChI | InChI=1S/C12H9F2N3S/c13-8-3-9(14)11-10(4-8)17(12(15)16-11)5-7-1-2-18-6-7/h1-4,6H,5H2,(H2,15,16) |
| InChIKey | MZKZDGSAZKEALC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |