C11H13F2N3O2S — CID 115508787
4,6-difluoro-1-(3-methylsulfonylpropyl)benzimidazol-2-amine (PubChem CID 115508787) has the molecular formula C11H13F2N3O2S and a molecular weight of 289.31 g/mol. Its IUPAC name is 4,6-difluoro-1-(3-methylsulfonylpropyl)benzimidazol-2-amine.
| Compound Name | 4,6-difluoro-1-(3-methylsulfonylpropyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115508787 |
| Molecular Formula | C11H13F2N3O2S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4,6-difluoro-1-(3-methylsulfonylpropyl)benzimidazol-2-amine |
| SMILES | CS(=O)(=O)CCCn1c(N)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C11H13F2N3O2S/c1-19(17,18)4-2-3-16-9-6-7(12)5-8(13)10(9)15-11(16)14/h5-6H,2-4H2,1H3,(H2,14,15) |
| InChIKey | ACPQUZCOGODENL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |