C13H15ClF2N2O2S — CID 115509367
2-(1-chloroethyl)-4,6-difluoro-1-(3-methylsulfonylpropyl)benzimidazole (PubChem CID 115509367) has the molecular formula C13H15ClF2N2O2S and a molecular weight of 336.79 g/mol. Its IUPAC name is 2-(1-chloroethyl)-4,6-difluoro-1-(3-methylsulfonylpropyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-4,6-difluoro-1-(3-methylsulfonylpropyl)benzimidazole |
|---|---|
| PubChem CID | 115509367 |
| Molecular Formula | C13H15ClF2N2O2S |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-(1-chloroethyl)-4,6-difluoro-1-(3-methylsulfonylpropyl)benzimidazole |
| SMILES | CC(Cl)c1nc2c(F)cc(F)cc2n1CCCS(C)(=O)=O |
| InChI | InChI=1S/C13H15ClF2N2O2S/c1-8(14)13-17-12-10(16)6-9(15)7-11(12)18(13)4-3-5-21(2,19)20/h6-8H,3-5H2,1-2H3 |
| InChIKey | LFDKXFLETFDQHQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|