C13H14ClF2N3O — CID 115509407
2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-2-methylpropanamide (PubChem CID 115509407) has the molecular formula C13H14ClF2N3O and a molecular weight of 301.72 g/mol. Its IUPAC name is 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-2-methylpropanamide.
| Compound Name | 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 115509407 |
| Molecular Formula | C13H14ClF2N3O |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]-2-methylpropanamide |
| SMILES | CC(Cl)c1nc2c(F)cc(F)cc2n1C(C)(C)C(N)=O |
| InChI | InChI=1S/C13H14ClF2N3O/c1-6(14)11-18-10-8(16)4-7(15)5-9(10)19(11)13(2,3)12(17)20/h4-6H,1-3H3,(H2,17,20) |
| InChIKey | LOSCNYNMZZISLS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|