C13H12ClF2N5 — CID 115509436
2-(1-chloroethyl)-4,6-difluoro-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole (PubChem CID 115509436) has the molecular formula C13H12ClF2N5 and a molecular weight of 311.72 g/mol. Its IUPAC name is 2-(1-chloroethyl)-4,6-difluoro-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole.
| Compound Name | 2-(1-chloroethyl)-4,6-difluoro-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 115509436 |
| Molecular Formula | C13H12ClF2N5 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(1-chloroethyl)-4,6-difluoro-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzimidazole |
| SMILES | CC(Cl)c1nc2c(F)cc(F)cc2n1Cc1nncn1C |
| InChI | InChI=1S/C13H12ClF2N5/c1-7(14)13-18-12-9(16)3-8(15)4-10(12)21(13)5-11-19-17-6-20(11)2/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | OCUUQYRSOSNLBO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|