C14H10BrClF2N2S — CID 115509554
1-[(5-bromothiophen-2-yl)methyl]-2-(1-chloroethyl)-4,6-difluorobenzimidazole (PubChem CID 115509554) has the molecular formula C14H10BrClF2N2S and a molecular weight of 391.67 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-(1-chloroethyl)-4,6-difluorobenzimidazole.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-(1-chloroethyl)-4,6-difluorobenzimidazole |
|---|---|
| PubChem CID | 115509554 |
| Molecular Formula | C14H10BrClF2N2S |
| Molecular Weight | 391.67 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-(1-chloroethyl)-4,6-difluorobenzimidazole |
| SMILES | CC(Cl)c1nc2c(F)cc(F)cc2n1Cc1ccc(Br)s1 |
| InChI | InChI=1S/C14H10BrClF2N2S/c1-7(16)14-19-13-10(18)4-8(17)5-11(13)20(14)6-9-2-3-12(15)21-9/h2-5,7H,6H2,1H3 |
| InChIKey | MZEJKKOLPWIQNR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|