C12H11ClF2N2O2 — CID 113325656
methyl 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]acetate (PubChem CID 113325656) has the molecular formula C12H11ClF2N2O2 and a molecular weight of 288.68 g/mol. Its IUPAC name is methyl 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]acetate.
| Compound Name | methyl 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 113325656 |
| Molecular Formula | C12H11ClF2N2O2 |
| Molecular Weight | 288.68 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | methyl 2-[2-(1-chloroethyl)-4,6-difluorobenzimidazol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(C(C)Cl)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H11ClF2N2O2/c1-6(13)12-16-11-8(15)3-7(14)4-9(11)17(12)5-10(18)19-2/h3-4,6H,5H2,1-2H3 |
| InChIKey | UAAQZTUOKVBOTC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|