C14H10Cl2F2N2S — CID 115509551
2-(1-chloroethyl)-1-[(5-chlorothiophen-2-yl)methyl]-4,6-difluorobenzimidazole (PubChem CID 115509551) has the molecular formula C14H10Cl2F2N2S and a molecular weight of 347.22 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-[(5-chlorothiophen-2-yl)methyl]-4,6-difluorobenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-[(5-chlorothiophen-2-yl)methyl]-4,6-difluorobenzimidazole |
|---|---|
| PubChem CID | 115509551 |
| Molecular Formula | C14H10Cl2F2N2S |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 2-(1-chloroethyl)-1-[(5-chlorothiophen-2-yl)methyl]-4,6-difluorobenzimidazole |
| SMILES | CC(Cl)c1nc2c(F)cc(F)cc2n1Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H10Cl2F2N2S/c1-7(15)14-19-13-10(18)4-8(17)5-11(13)20(14)6-9-2-3-12(16)21-9/h2-5,7H,6H2,1H3 |
| InChIKey | JYCBHVZXEYYUAS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|