C12H14BrClFN3O2S — CID 66086336
N-[2-[5-bromo-2-(1-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]methanesulfonamide (PubChem CID 66086336) has the molecular formula C12H14BrClFN3O2S and a molecular weight of 398.69 g/mol. Its IUPAC name is N-[2-[5-bromo-2-(1-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[5-bromo-2-(1-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 66086336 |
| Molecular Formula | C12H14BrClFN3O2S |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | N-[2-[5-bromo-2-(1-chloroethyl)-6-fluorobenzimidazol-1-yl]ethyl]methanesulfonamide |
| SMILES | CC(Cl)c1nc2cc(Br)c(F)cc2n1CCNS(C)(=O)=O |
| InChI | InChI=1S/C12H14BrClFN3O2S/c1-7(14)12-17-10-5-8(13)9(15)6-11(10)18(12)4-3-16-21(2,19)20/h5-7,16H,3-4H2,1-2H3 |
| InChIKey | OYMUOIILZVDKJG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|