C12H15Cl2N3O2S — CID 43667669
N-[2-[7-chloro-2-(1-chloroethyl)benzimidazol-1-yl]ethyl]methanesulfonamide (PubChem CID 43667669) has the molecular formula C12H15Cl2N3O2S and a molecular weight of 336.24 g/mol. Its IUPAC name is N-[2-[7-chloro-2-(1-chloroethyl)benzimidazol-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[7-chloro-2-(1-chloroethyl)benzimidazol-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43667669 |
| Molecular Formula | C12H15Cl2N3O2S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-[2-[7-chloro-2-(1-chloroethyl)benzimidazol-1-yl]ethyl]methanesulfonamide |
| SMILES | CC(Cl)c1nc2cccc(Cl)c2n1CCNS(C)(=O)=O |
| InChI | InChI=1S/C12H15Cl2N3O2S/c1-8(13)12-16-10-5-3-4-9(14)11(10)17(12)7-6-15-20(2,18)19/h3-5,8,15H,6-7H2,1-2H3 |
| InChIKey | JOHXMMXJXSVSDL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|