C14H18Cl2N2 — CID 63544860
7-chloro-2-(1-chloroethyl)-1-(2,2-dimethylpropyl)benzimidazole (PubChem CID 63544860) has the molecular formula C14H18Cl2N2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 7-chloro-2-(1-chloroethyl)-1-(2,2-dimethylpropyl)benzimidazole.
| Compound Name | 7-chloro-2-(1-chloroethyl)-1-(2,2-dimethylpropyl)benzimidazole |
|---|---|
| PubChem CID | 63544860 |
| Molecular Formula | C14H18Cl2N2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 7-chloro-2-(1-chloroethyl)-1-(2,2-dimethylpropyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cccc(Cl)c2n1CC(C)(C)C |
| InChI | InChI=1S/C14H18Cl2N2/c1-9(15)13-17-11-7-5-6-10(16)12(11)18(13)8-14(2,3)4/h5-7,9H,8H2,1-4H3 |
| InChIKey | OBZHFLLLPVBMOF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|