C15H20Cl2N2 — CID 103463020
7-chloro-2-(1-chloroethyl)-1-(2,2-dimethylbutyl)benzimidazole (PubChem CID 103463020) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 7-chloro-2-(1-chloroethyl)-1-(2,2-dimethylbutyl)benzimidazole.
| Compound Name | 7-chloro-2-(1-chloroethyl)-1-(2,2-dimethylbutyl)benzimidazole |
|---|---|
| PubChem CID | 103463020 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 7-chloro-2-(1-chloroethyl)-1-(2,2-dimethylbutyl)benzimidazole |
| SMILES | CCC(C)(C)Cn1c(C(C)Cl)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C15H20Cl2N2/c1-5-15(3,4)9-19-13-11(17)7-6-8-12(13)18-14(19)10(2)16/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | UYDMTUGOWNBFQB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|