C10H13ClN4O2S — CID 43662133
N-[2-(2-amino-7-chlorobenzimidazol-1-yl)ethyl]methanesulfonamide (PubChem CID 43662133) has the molecular formula C10H13ClN4O2S and a molecular weight of 288.76 g/mol. Its IUPAC name is N-[2-(2-amino-7-chlorobenzimidazol-1-yl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(2-amino-7-chlorobenzimidazol-1-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43662133 |
| Molecular Formula | C10H13ClN4O2S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-[2-(2-amino-7-chlorobenzimidazol-1-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCn1c(N)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C10H13ClN4O2S/c1-18(16,17)13-5-6-15-9-7(11)3-2-4-8(9)14-10(15)12/h2-4,13H,5-6H2,1H3,(H2,12,14) |
| InChIKey | XIWKKMOORLYPHR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |