C12H11FN4S — CID 63240191
5-fluoro-1-[2-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine (PubChem CID 63240191) has the molecular formula C12H11FN4S and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-fluoro-1-[2-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 5-fluoro-1-[2-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 63240191 |
| Molecular Formula | C12H11FN4S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 5-fluoro-1-[2-(1,3-thiazol-2-yl)ethyl]benzimidazol-2-amine |
| SMILES | Nc1nc2cc(F)ccc2n1CCc1nccs1 |
| InChI | InChI=1S/C12H11FN4S/c13-8-1-2-10-9(7-8)16-12(14)17(10)5-3-11-15-4-6-18-11/h1-2,4,6-7H,3,5H2,(H2,14,16) |
| InChIKey | QCZBSQVWYISQJK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |