C11H9ClN4S — CID 54964595
5-chloro-1-(1,3-thiazol-2-ylmethyl)benzimidazol-2-amine (PubChem CID 54964595) has the molecular formula C11H9ClN4S and a molecular weight of 264.74 g/mol. Its IUPAC name is 5-chloro-1-(1,3-thiazol-2-ylmethyl)benzimidazol-2-amine.
| Compound Name | 5-chloro-1-(1,3-thiazol-2-ylmethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 54964595 |
| Molecular Formula | C11H9ClN4S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 5-chloro-1-(1,3-thiazol-2-ylmethyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)ccc2n1Cc1nccs1 |
| InChI | InChI=1S/C11H9ClN4S/c12-7-1-2-9-8(5-7)15-11(13)16(9)6-10-14-3-4-17-10/h1-5H,6H2,(H2,13,15) |
| InChIKey | YHKLTVRIPYSMSQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |