C12H13ClF3N3 — CID 115520901
5-chloro-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine (PubChem CID 115520901) has the molecular formula C12H13ClF3N3 and a molecular weight of 291.70 g/mol. Its IUPAC name is 5-chloro-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine.
| Compound Name | 5-chloro-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115520901 |
| Molecular Formula | C12H13ClF3N3 |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-chloro-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Cl)ccc2n1CCCCC(F)(F)F |
| InChI | InChI=1S/C12H13ClF3N3/c13-8-3-4-10-9(7-8)18-11(17)19(10)6-2-1-5-12(14,15)16/h3-4,7H,1-2,5-6H2,(H2,17,18) |
| InChIKey | ZWQYFNRRUCSCJB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|