C13H16F3N3 — CID 115520922
6-methyl-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine (PubChem CID 115520922) has the molecular formula C13H16F3N3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 6-methyl-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine.
| Compound Name | 6-methyl-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115520922 |
| Molecular Formula | C13H16F3N3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 6-methyl-1-(5,5,5-trifluoropentyl)benzimidazol-2-amine |
| SMILES | Cc1ccc2nc(N)n(CCCCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C13H16F3N3/c1-9-4-5-10-11(8-9)19(12(17)18-10)7-3-2-6-13(14,15)16/h4-5,8H,2-3,6-7H2,1H3,(H2,17,18) |
| InChIKey | SSXWDDYFGHOYDI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|