C14H15F3N2O2 — CID 82774842
2-methyl-3-(5,5,5-trifluoropentyl)benzimidazole-5-carboxylic acid (PubChem CID 82774842) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-methyl-3-(5,5,5-trifluoropentyl)benzimidazole-5-carboxylic acid.
| Compound Name | 2-methyl-3-(5,5,5-trifluoropentyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82774842 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-methyl-3-(5,5,5-trifluoropentyl)benzimidazole-5-carboxylic acid |
| SMILES | Cc1nc2ccc(C(=O)O)cc2n1CCCCC(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O2/c1-9-18-11-5-4-10(13(20)21)8-12(11)19(9)7-3-2-6-14(15,16)17/h4-5,8H,2-3,6-7H2,1H3,(H,20,21) |
| InChIKey | LNTHCXFSYIZMRL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|