C14H18N2O2 — CID 82791290
2-methyl-3-pentylbenzimidazole-5-carboxylic acid (PubChem CID 82791290) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-methyl-3-pentylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-methyl-3-pentylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82791290 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-methyl-3-pentylbenzimidazole-5-carboxylic acid |
| SMILES | CCCCCn1c(C)nc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C14H18N2O2/c1-3-4-5-8-16-10(2)15-12-7-6-11(14(17)18)9-13(12)16/h6-7,9H,3-5,8H2,1-2H3,(H,17,18) |
| InChIKey | PUOYZQXESWGYQT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|