C13H17N3O4S — CID 106339674
3-[2-(dimethylsulfamoyl)ethyl]-2-methylbenzimidazole-5-carboxylic acid (PubChem CID 106339674) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-[2-(dimethylsulfamoyl)ethyl]-2-methylbenzimidazole-5-carboxylic acid.
| Compound Name | 3-[2-(dimethylsulfamoyl)ethyl]-2-methylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 106339674 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-[2-(dimethylsulfamoyl)ethyl]-2-methylbenzimidazole-5-carboxylic acid |
| SMILES | Cc1nc2ccc(C(=O)O)cc2n1CCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H17N3O4S/c1-9-14-11-5-4-10(13(17)18)8-12(11)16(9)6-7-21(19,20)15(2)3/h4-5,8H,6-7H2,1-3H3,(H,17,18) |
| InChIKey | HKGUOYBJIXUACD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |